Products 141516-55-4
CAS 141516-55-4 appears in our catalog under these names: 2,2,2-Trifluoroethyl 4-nitrobenzenesulfonate, 95%, 2,2,2-Trifluoroethyl 4-nitrobenzene-1-sulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,2,2-trifluoroethyl 4-nitrobenzenesulfonate (CAS 141516-55-4) is a chemical compound with the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. IUPAC name: 2,2,2-trifluoroethyl 4-nitrobenzenesulfonate. InChIKey: NWMYQQUAXHWACZ-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO5S |
|---|---|
| Molecular weight | 285.20 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl 4-nitrobenzenesulfonate |
| InChIKey | NWMYQQUAXHWACZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])S(=O)(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)