CAS 145209-21-8 is the registry number for 2-Nitro-m-tolyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3-methyl-2-nitrophenyl) trifluoromethanesulfonate (CAS 145209-21-8) is a chemical compound with the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. IUPAC name: (3-methyl-2-nitrophenyl) trifluoromethanesulfonate. InChIKey: VDOLNKPQOQPEFX-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO5S |
|---|---|
| Molecular weight | 285.20 g/mol |
| IUPAC name | (3-methyl-2-nitrophenyl) trifluoromethanesulfonate |
| InChIKey | VDOLNKPQOQPEFX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)