CAS 1446016-49-4 is the registry number for 2-Methyl-3-nitrophenyl triflate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2-methyl-3-nitrophenyl) trifluoromethanesulfonate (CAS 1446016-49-4) is a chemical compound with the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. IUPAC name: (2-methyl-3-nitrophenyl) trifluoromethanesulfonate. InChIKey: RRSCNISMYHCNPO-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO5S |
|---|---|
| Molecular weight | 285.20 g/mol |
| IUPAC name | (2-methyl-3-nitrophenyl) trifluoromethanesulfonate |
| InChIKey | RRSCNISMYHCNPO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1OS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)