Products 256936-08-0

CAS 256936-08-0 is the registry number for 4-Nitro-3-methylphenyl triflate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(3-methyl-4-nitrophenyl) trifluoromethanesulfonate (CAS 256936-08-0) is a chemical compound with the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. IUPAC name: (3-methyl-4-nitrophenyl) trifluoromethanesulfonate. InChIKey: YGSJYBHOBLWPML-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6F3NO5S
Molecular weight285.20 g/mol
IUPAC name(3-methyl-4-nitrophenyl) trifluoromethanesulfonate
InChIKeyYGSJYBHOBLWPML-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1)OS(=O)(=O)C(F)(F)F)[N+](=O)[O-]

Computed by PubChem (NCBI)