CAS 256936-08-0 is the registry number for 4-Nitro-3-methylphenyl triflate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(3-methyl-4-nitrophenyl) trifluoromethanesulfonate (CAS 256936-08-0) is a chemical compound with the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. IUPAC name: (3-methyl-4-nitrophenyl) trifluoromethanesulfonate. InChIKey: YGSJYBHOBLWPML-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO5S |
|---|---|
| Molecular weight | 285.20 g/mol |
| IUPAC name | (3-methyl-4-nitrophenyl) trifluoromethanesulfonate |
| InChIKey | YGSJYBHOBLWPML-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OS(=O)(=O)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)