CAS 2922291-65-2 is the registry number for 2-Formyl-5-methoxypyridin-4-yl trifluoromethanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2-formyl-5-methoxy-4-pyridinyl) trifluoromethanesulfonate (CAS 2922291-65-2) is a chemical compound with the molecular formula C8H6F3NO5S and a molecular weight of 285.20 g/mol. IUPAC name: (2-formyl-5-methoxy-4-pyridinyl) trifluoromethanesulfonate. InChIKey: LVYRZVDFYQIXOV-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO5S |
|---|---|
| Molecular weight | 285.20 g/mol |
| IUPAC name | (2-formyl-5-methoxy-4-pyridinyl) trifluoromethanesulfonate |
| InChIKey | LVYRZVDFYQIXOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(N=C1)C=O)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)