CAS 1415830-89-5 appears in our catalog under these names: Florfenicol Impurity 11, Florfenicol Impurity 8. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2R,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate (CAS 1415830-89-5) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: ethyl (2R,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate. InChIKey: CEEHCOWSYFANRT-GHMZBOCLSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | ethyl (2R,3R)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate |
| InChIKey | CEEHCOWSYFANRT-GHMZBOCLSA-N |
| SMILES | CCOC(=O)[C@@H]([C@@H](C1=CC=C(C=C1)S(=O)(=O)C)O)N |
Computed by PubChem (NCBI)