CAS 1415830-90-8 appears in our catalog under these names: Florfenicol Impurity 10, Florfenicol Impurity 9. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,3S)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate (CAS 1415830-90-8) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: ethyl (2S,3S)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate. InChIKey: CEEHCOWSYFANRT-QWRGUYRKSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | ethyl (2S,3S)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate |
| InChIKey | CEEHCOWSYFANRT-QWRGUYRKSA-N |
| SMILES | CCOC(=O)[C@H]([C@H](C1=CC=C(C=C1)S(=O)(=O)C)O)N |
Computed by PubChem (NCBI)