Products 31925-27-6
CAS 31925-27-6 is the registry number for Florfenicol Impurity 11. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate (CAS 31925-27-6) is a chemical compound with the molecular formula C12H17NO5S and a molecular weight of 287.33 g/mol. IUPAC name: ethyl (2S)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate. InChIKey: CEEHCOWSYFANRT-VUWPPUDQSA-N.
| Molecular formula | C12H17NO5S |
|---|---|
| Molecular weight | 287.33 g/mol |
| IUPAC name | ethyl (2S)-2-amino-3-hydroxy-3-(4-methylsulfonylphenyl)propanoate |
| InChIKey | CEEHCOWSYFANRT-VUWPPUDQSA-N |
| SMILES | CCOC(=O)[C@H](C(C1=CC=C(C=C1)S(=O)(=O)C)O)N |
Computed by PubChem (NCBI)