Products 1416352-15-2

CAS 1416352-15-2 is the registry number for 4-Bromo-3-chloro-5-methylbenzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-bromo-3-chloro-5-methylbenzoic acid (CAS 1416352-15-2) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 4-bromo-3-chloro-5-methylbenzoic acid. InChIKey: LYNHENCALWCBLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6BrClO2
Molecular weight249.49 g/mol
IUPAC name4-bromo-3-chloro-5-methylbenzoic acid
InChIKeyLYNHENCALWCBLJ-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1Br)Cl)C(=O)O

Computed by PubChem (NCBI)