Products 1416371-86-2

CAS 1416371-86-2 is the registry number for 1-tert-Butyl 2-methyl 4-aminopiperidine-1,2-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-methyl 4-aminopiperidine-1,2-dicarboxylate (CAS 1416371-86-2) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-aminopiperidine-1,2-dicarboxylate. InChIKey: PVCVXOYIRODFJD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H22N2O4
Molecular weight258.31 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 4-aminopiperidine-1,2-dicarboxylate
InChIKeyPVCVXOYIRODFJD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1C(=O)OC)N

Computed by PubChem (NCBI)