CAS 254882-09-2 appears in our catalog under these names: O1-tert-butyl O2-methyl (2S,4S)-4-aminopiperidine-1,2-dicarboxylate, 98%, 98%, (2S,4S)-1-tert-Butyl 2-methyl 4-aminopiperidine-1,2-dicarboxylate, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g, 5g.
1-O-tert-butyl 2-O-methyl (2S,4S)-4-aminopiperidine-1,2-dicarboxylate (CAS 254882-09-2) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-aminopiperidine-1,2-dicarboxylate. InChIKey: PVCVXOYIRODFJD-IUCAKERBSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-aminopiperidine-1,2-dicarboxylate |
| InChIKey | PVCVXOYIRODFJD-IUCAKERBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C[C@H]1C(=O)OC)N |
Computed by PubChem (NCBI)