CAS 778646-95-0 appears in our catalog under these names: (2R,4R)-1-tert-Butyl 2-methyl 4-aminopiperidine-1,2-dicarboxylate, 95%, 95%, 1-(tert-Butyl) 2-methyl (2r,4r)-4-aminopiperidine-1,2-dicarboxylate, 95%, 1-(TERT-BUTYL) 2-METHYL (2R,4R)-4-AMINOPIPERIDINE-1,2-DICARBOXYLATE, 98%, (2R,4R)-1-tert-Butyl 2-methyl 4-aminopiperidine-1,2-dicarboxylate, 97%. Offered by: Chemat, Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1-O-tert-butyl 2-O-methyl (2R,4R)-4-aminopiperidine-1,2-dicarboxylate (CAS 778646-95-0) is a chemical compound with the molecular formula C12H22N2O4 and a molecular weight of 258.31 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4R)-4-aminopiperidine-1,2-dicarboxylate. InChIKey: PVCVXOYIRODFJD-RKDXNWHRSA-N.
| Molecular formula | C12H22N2O4 |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-aminopiperidine-1,2-dicarboxylate |
| InChIKey | PVCVXOYIRODFJD-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C[C@@H]1C(=O)OC)N |
Computed by PubChem (NCBI)