Products 1416373-68-6

CAS 1416373-68-6 is the registry number for 4-Benzyl-6-methylmorpholine-2-carboxylic acid, 97+%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-benzyl-6-methylmorpholine-2-carboxylic acid (CAS 1416373-68-6) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: 4-benzyl-6-methylmorpholine-2-carboxylic acid. InChIKey: ZLRZZFSVXLJZFW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H17NO3
Molecular weight235.28 g/mol
IUPAC name4-benzyl-6-methylmorpholine-2-carboxylic acid
InChIKeyZLRZZFSVXLJZFW-UHFFFAOYSA-N
SMILESCC1CN(CC(O1)C(=O)O)CC2=CC=CC=C2

Computed by PubChem (NCBI)