Products 1932178-65-8

CAS 1932178-65-8 is the registry number for (2S,6S)-4-BENZYL-6-METHYLMORPHOLINE-2-CARBOXYLIC ACID, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(2S,6S)-4-benzyl-6-methylmorpholine-2-carboxylic acid (CAS 1932178-65-8) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: (2S,6S)-4-benzyl-6-methylmorpholine-2-carboxylic acid. InChIKey: ZLRZZFSVXLJZFW-JQWIXIFHSA-N.

Identity
Molecular formulaC13H17NO3
Molecular weight235.28 g/mol
IUPAC name(2S,6S)-4-benzyl-6-methylmorpholine-2-carboxylic acid
InChIKeyZLRZZFSVXLJZFW-JQWIXIFHSA-N
SMILESC[C@H]1CN(C[C@H](O1)C(=O)O)CC2=CC=CC=C2

Computed by PubChem (NCBI)