Products 2381513-30-8
CAS 2381513-30-8 is the registry number for (2S,6R)-4-Benzyl-6-methylmorpholine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,6R)-4-benzyl-6-methylmorpholine-2-carboxylic acid (CAS 2381513-30-8) is a chemical compound with the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. IUPAC name: (2S,6R)-4-benzyl-6-methylmorpholine-2-carboxylic acid. InChIKey: ZLRZZFSVXLJZFW-PWSUYJOCSA-N.
| Molecular formula | C13H17NO3 |
|---|---|
| Molecular weight | 235.28 g/mol |
| IUPAC name | (2S,6R)-4-benzyl-6-methylmorpholine-2-carboxylic acid |
| InChIKey | ZLRZZFSVXLJZFW-PWSUYJOCSA-N |
| SMILES | C[C@@H]1CN(C[C@H](O1)C(=O)O)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)