CAS 1416447-75-0 appears in our catalog under these names: 4-(4-Fluorobenzoyl)-1H-1,2,3-triazole, 95%, 4-(4-Fluorobenzoyl)-1H-1,2,3-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
(4-fluorophenyl)-(2H-triazol-4-yl)methanone (CAS 1416447-75-0) is a chemical compound with the molecular formula C9H6FN3O and a molecular weight of 191.16 g/mol. IUPAC name: (4-fluorophenyl)-(2H-triazol-4-yl)methanone. InChIKey: AQUKDMANPBWYSE-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | (4-fluorophenyl)-(2H-triazol-4-yl)methanone |
| InChIKey | AQUKDMANPBWYSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=NNN=C2)F |
Computed by PubChem (NCBI)