CAS 712-73-2 appears in our catalog under these names: 2-(4-Fluoro-phenyl)-2h-[1,2,3]triazole-4-carbaldehyde, 95%, 2-(4-Fluorophenyl)-2H-1,2,3-triazole-4-carbaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-(4-fluorophenyl)triazole-4-carbaldehyde (CAS 712-73-2) is a chemical compound with the molecular formula C9H6FN3O and a molecular weight of 191.16 g/mol. IUPAC name: 2-(4-fluorophenyl)triazole-4-carbaldehyde. InChIKey: JHUJECFDLYXNPK-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 2-(4-fluorophenyl)triazole-4-carbaldehyde |
| InChIKey | JHUJECFDLYXNPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2N=CC(=N2)C=O)F |
Computed by PubChem (NCBI)