CAS 95727-87-0 appears in our catalog under these names: 3-(4-Fluorobenzoyl)-4H-1,2,4-triazole, 95%, 3-(4-Fluorobenzoyl)-4H-1,2,4-triazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(4-fluorophenyl)-(1H-1,2,4-triazol-5-yl)methanone (CAS 95727-87-0) is a chemical compound with the molecular formula C9H6FN3O and a molecular weight of 191.16 g/mol. IUPAC name: (4-fluorophenyl)-(1H-1,2,4-triazol-5-yl)methanone. InChIKey: XPKHJVCFEVGUPP-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | (4-fluorophenyl)-(1H-1,2,4-triazol-5-yl)methanone |
| InChIKey | XPKHJVCFEVGUPP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=NC=NN2)F |
Computed by PubChem (NCBI)