CAS 578703-90-9 is the registry number for 1-(4-Fluorophenyl)-1H-1,2,3-triazole-4-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(4-fluorophenyl)triazole-4-carbaldehyde (CAS 578703-90-9) is a chemical compound with the molecular formula C9H6FN3O and a molecular weight of 191.16 g/mol. IUPAC name: 1-(4-fluorophenyl)triazole-4-carbaldehyde. InChIKey: VDZWNFKDNJZMGG-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 1-(4-fluorophenyl)triazole-4-carbaldehyde |
| InChIKey | VDZWNFKDNJZMGG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)C=O)F |
Computed by PubChem (NCBI)