CAS 944897-38-5 is the registry number for 5-(2-Fluorophenyl)-4h-1,2,4-triazole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(2-fluorophenyl)-1H-1,2,4-triazole-5-carbaldehyde (CAS 944897-38-5) is a chemical compound with the molecular formula C9H6FN3O and a molecular weight of 191.16 g/mol. IUPAC name: 3-(2-fluorophenyl)-1H-1,2,4-triazole-5-carbaldehyde. InChIKey: GYXJUVKOAMPPLZ-UHFFFAOYSA-N.
| Molecular formula | C9H6FN3O |
|---|---|
| Molecular weight | 191.16 g/mol |
| IUPAC name | 3-(2-fluorophenyl)-1H-1,2,4-triazole-5-carbaldehyde |
| InChIKey | GYXJUVKOAMPPLZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NNC(=N2)C=O)F |
Computed by PubChem (NCBI)