CAS 1416980-80-7 is the registry number for 1-(4-Vinylphenyl)-1h-1,2,4-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-(4-ethenylphenyl)-1,2,4-triazole (CAS 1416980-80-7) is a chemical compound with the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. IUPAC name: 1-(4-ethenylphenyl)-1,2,4-triazole. InChIKey: PFWJXCVMIAJUOO-UHFFFAOYSA-N.
| Molecular formula | C10H9N3 |
|---|---|
| Molecular weight | 171.20 g/mol |
| IUPAC name | 1-(4-ethenylphenyl)-1,2,4-triazole |
| InChIKey | PFWJXCVMIAJUOO-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)N2C=NC=N2 |
Computed by PubChem (NCBI)