Products 14181-26-1
CAS 14181-26-1 appears in our catalog under these names: 1,4–Bis(3,5–dimethyl–1H–pyrazol–4–yl)benzene, 1,4-Bis(3,5-dimethyl-1H-pyrazol-4-yl)benzene, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 200mg, 100mg, 250mg, 1g.
4-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-3,5-dimethyl-1H-pyrazole (CAS 14181-26-1) is a chemical compound with the molecular formula C16H18N4 and a molecular weight of 266.34 g/mol. IUPAC name: 4-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-3,5-dimethyl-1H-pyrazole. InChIKey: JTBBGJWFYXAFGX-UHFFFAOYSA-N.
| Molecular formula | C16H18N4 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 4-[4-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-3,5-dimethyl-1H-pyrazole |
| InChIKey | JTBBGJWFYXAFGX-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC=C(C=C2)C3=C(NN=C3C)C |
Computed by PubChem (NCBI)