CAS 1702706-59-9 is the registry number for 5-((3R,5S)-3-Amino-5-methylpiperidin-1-yl)quinoline-8-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-[(3R,5S)-3-amino-5-methylpiperidin-1-yl]quinoline-8-carbonitrile (CAS 1702706-59-9) is a chemical compound with the molecular formula C16H18N4 and a molecular weight of 266.34 g/mol. IUPAC name: 5-[(3R,5S)-3-amino-5-methylpiperidin-1-yl]quinoline-8-carbonitrile. InChIKey: MPGCORKREKQAST-WCQYABFASA-N.
| Molecular formula | C16H18N4 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 5-[(3R,5S)-3-amino-5-methylpiperidin-1-yl]quinoline-8-carbonitrile |
| InChIKey | MPGCORKREKQAST-WCQYABFASA-N |
| SMILES | C[C@H]1C[C@H](CN(C1)C2=C3C=CC=NC3=C(C=C2)C#N)N |
Computed by PubChem (NCBI)