CAS 897373-62-5 is the registry number for 3-(tert-Butyl)-1-(quinolin-6-yl)-1H-pyrazol-5-amine. Offered by: Biosynth. Available pack sizes: 50mg.
3-tert-butyl-1-quinolin-6-ylpyrazol-5-amine (CAS 897373-62-5) is a chemical compound with the molecular formula C16H18N4 and a molecular weight of 266.34 g/mol. IUPAC name: 3-tert-butyl-1-quinolin-6-ylpyrazol-5-amine. InChIKey: XSVUNUCMJQXEBA-UHFFFAOYSA-N.
| Molecular formula | C16H18N4 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 3-tert-butyl-1-quinolin-6-ylpyrazol-5-amine |
| InChIKey | XSVUNUCMJQXEBA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NN(C(=C1)N)C2=CC3=C(C=C2)N=CC=C3 |
Computed by PubChem (NCBI)