CAS 872576-53-9 is the registry number for 4,4′-(1,3-Phenylene)bis[3,5-dimethyl-1H-pyrazole], 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[3-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-3,5-dimethyl-1H-pyrazole (CAS 872576-53-9) is a chemical compound with the molecular formula C16H18N4 and a molecular weight of 266.34 g/mol. IUPAC name: 4-[3-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-3,5-dimethyl-1H-pyrazole. InChIKey: SPSIBNNFBQEAHA-UHFFFAOYSA-N.
| Molecular formula | C16H18N4 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 4-[3-(3,5-dimethyl-1H-pyrazol-4-yl)phenyl]-3,5-dimethyl-1H-pyrazole |
| InChIKey | SPSIBNNFBQEAHA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)C2=CC(=CC=C2)C3=C(NN=C3C)C |
Computed by PubChem (NCBI)