Products 169516-12-5
CAS 169516-12-5 is the registry number for N4,N4,N7,N7-Tetramethyl-1,10-phenanthroline-4,7-diamine, 95%. Offered by: AmBeed. Available pack sizes: 100mg, 1g.
4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine (CAS 169516-12-5) is a chemical compound with the molecular formula C16H18N4 and a molecular weight of 266.34 g/mol. IUPAC name: 4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine. InChIKey: NCYCPKJOUZGQJG-UHFFFAOYSA-N.
| Molecular formula | C16H18N4 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | 4-N,4-N,7-N,7-N-tetramethyl-1,10-phenanthroline-4,7-diamine |
| InChIKey | NCYCPKJOUZGQJG-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C2C=CC3=C(C=CN=C3C2=NC=C1)N(C)C |
Computed by PubChem (NCBI)