Products 1419604-69-5
CAS 1419604-69-5 is the registry number for 6-(2,2-Dimethyl-1,3-dioxolan-4-yl)pyridin-3-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2,2-dimethyl-1,3-dioxolan-4-yl)pyridin-3-amine (CAS 1419604-69-5) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 6-(2,2-dimethyl-1,3-dioxolan-4-yl)pyridin-3-amine. InChIKey: KNVGFQWXGOKJHK-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 6-(2,2-dimethyl-1,3-dioxolan-4-yl)pyridin-3-amine |
| InChIKey | KNVGFQWXGOKJHK-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)C2=NC=C(C=C2)N)C |
Computed by PubChem (NCBI)