CAS 2877757-09-8 is the registry number for 6-[(4R)-2,2-Dimethyl-1,3-dioxolan-4-yl]-3-pyridinamine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyridin-3-amine (CAS 2877757-09-8) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyridin-3-amine. InChIKey: KNVGFQWXGOKJHK-VIFPVBQESA-N.
| Molecular formula | C10H14N2O2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]pyridin-3-amine |
| InChIKey | KNVGFQWXGOKJHK-VIFPVBQESA-N |
| SMILES | CC1(OC[C@H](O1)C2=NC=C(C=C2)N)C |
Computed by PubChem (NCBI)