CAS 1421438-84-7 is the registry number for (4,4,4-Trifluorobutanoyl)-L-alanine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-(4,4,4-trifluorobutanoylamino)propanoic acid (CAS 1421438-84-7) is a chemical compound with the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. IUPAC name: (2S)-2-(4,4,4-trifluorobutanoylamino)propanoic acid. InChIKey: ANLRCVLRDIIGKK-BYPYZUCNSA-N.
| Molecular formula | C7H10F3NO3 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | (2S)-2-(4,4,4-trifluorobutanoylamino)propanoic acid |
| InChIKey | ANLRCVLRDIIGKK-BYPYZUCNSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)CCC(F)(F)F |
Computed by PubChem (NCBI)