CAS 155749-20-5 is the registry number for Ethyl (2S)-2-(trifluoroacetamido)propanoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Ethyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (CAS 155749-20-5) is a chemical compound with the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. IUPAC name: ethyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate. InChIKey: ZCDYVEXWCKFMGY-BYPYZUCNSA-N.
| Molecular formula | C7H10F3NO3 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | ethyl (2S)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| InChIKey | ZCDYVEXWCKFMGY-BYPYZUCNSA-N |
| SMILES | CCOC(=O)[C@H](C)NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)