Products 1597771-06-6
CAS 1597771-06-6 is the registry number for 3-Oxa-6-azabicyclo[3.1.1]heptane trifluoroacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid (CAS 1597771-06-6) is a chemical compound with the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. IUPAC name: 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid. InChIKey: ZHTUKSCLFOSOMO-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO3 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | 3-oxa-6-azabicyclo[3.1.1]heptane;2,2,2-trifluoroacetic acid |
| InChIKey | ZHTUKSCLFOSOMO-UHFFFAOYSA-N |
| SMILES | C1C2COCC1N2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)