CAS 1909347-88-1 appears in our catalog under these names: 6-Oxa-1-azaspiro(3.3)heptane 2,2,2-trifluoroacetate, 98%, 6-oxa-1-azaspiro[3.3]heptane, trifluoroacetic acid, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 25g, 250mg, 500mg, 1g, 5g.
6-oxa-1-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid (CAS 1909347-88-1) is a chemical compound with the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. IUPAC name: 6-oxa-1-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid. InChIKey: ANDWKUJHIWYOHX-UHFFFAOYSA-N.
| Molecular formula | C7H10F3NO3 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | 6-oxa-1-azaspiro[3.3]heptane;2,2,2-trifluoroacetic acid |
| InChIKey | ANDWKUJHIWYOHX-UHFFFAOYSA-N |
| SMILES | C1CNC12COC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)