Products 26629-29-8

CAS 26629-29-8 is the registry number for Ethyl N-(trifluoroacetyl)-2-Aminopropanoate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Ethyl 2-[(2,2,2-trifluoroacetyl)amino]propanoate (CAS 26629-29-8) is a chemical compound with the molecular formula C7H10F3NO3 and a molecular weight of 213.15 g/mol. IUPAC name: ethyl 2-[(2,2,2-trifluoroacetyl)amino]propanoate. InChIKey: ZCDYVEXWCKFMGY-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F3NO3
Molecular weight213.15 g/mol
IUPAC nameethyl 2-[(2,2,2-trifluoroacetyl)amino]propanoate
InChIKeyZCDYVEXWCKFMGY-UHFFFAOYSA-N
SMILESCCOC(=O)C(C)NC(=O)C(F)(F)F

Computed by PubChem (NCBI)