CAS 1422051-73-7 appears in our catalog under these names: (R)-3-Amino-4,4-dimethyl-pentanoic acid methyl ester hydrochloride, 95%, Methyl (3R)-3-amino-4,4-dimethylpentanoate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 50mg, 0,5g.
Methyl (3R)-3-amino-4,4-dimethylpentanoate;hydrochloride (CAS 1422051-73-7) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl (3R)-3-amino-4,4-dimethylpentanoate;hydrochloride. InChIKey: VWWAVWOVOOLSTC-FYZOBXCZSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl (3R)-3-amino-4,4-dimethylpentanoate;hydrochloride |
| InChIKey | VWWAVWOVOOLSTC-FYZOBXCZSA-N |
| SMILES | CC(C)(C)[C@@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)