CAS 1439921-99-9 appears in our catalog under these names: (S)-Methyl 3-amino-4,4-dimethylpentanate hydrochloride, 95%, (S)-Methyl 3-amino-4,4-dimethylpentanoate hydrochloride, 97%, (S)–METHYL 3–AMINO–4,4–DIMETHYLPENTANATE HCL, (S)-Methyl 3-amino-4,4-dimethylpentanate hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 5g, 100mg.
Methyl (3S)-3-amino-4,4-dimethylpentanoate;hydrochloride (CAS 1439921-99-9) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: methyl (3S)-3-amino-4,4-dimethylpentanoate;hydrochloride. InChIKey: VWWAVWOVOOLSTC-RGMNGODLSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | methyl (3S)-3-amino-4,4-dimethylpentanoate;hydrochloride |
| InChIKey | VWWAVWOVOOLSTC-RGMNGODLSA-N |
| SMILES | CC(C)(C)[C@H](CC(=O)OC)N.Cl |
Computed by PubChem (NCBI)