CAS 142265-91-6 is the registry number for 2-Bromo-3-chloro-4,5-dimethoxybenzaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3-chloro-4,5-dimethoxybenzaldehyde (CAS 142265-91-6) is a chemical compound with the molecular formula C9H8BrClO3 and a molecular weight of 279.51 g/mol. IUPAC name: 2-bromo-3-chloro-4,5-dimethoxybenzaldehyde. InChIKey: BFQFSPIGVDMHRY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrClO3 |
|---|---|
| Molecular weight | 279.51 g/mol |
| IUPAC name | 2-bromo-3-chloro-4,5-dimethoxybenzaldehyde |
| InChIKey | BFQFSPIGVDMHRY-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)Br)Cl)OC |
Computed by PubChem (NCBI)