Products 1423025-29-9
CAS 1423025-29-9 is the registry number for 1-(5-Acetyl-2-ethyl-1-benzofuran-3-yl)ethan-1-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(3-acetyl-2-ethyl-1-benzofuran-5-yl)ethanone (CAS 1423025-29-9) is a chemical compound with the molecular formula C14H14O3 and a molecular weight of 230.26 g/mol. IUPAC name: 1-(3-acetyl-2-ethyl-1-benzofuran-5-yl)ethanone. InChIKey: NPJWIUILEOUXAD-UHFFFAOYSA-N.
| Molecular formula | C14H14O3 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 1-(3-acetyl-2-ethyl-1-benzofuran-5-yl)ethanone |
| InChIKey | NPJWIUILEOUXAD-UHFFFAOYSA-N |
| SMILES | CCC1=C(C2=C(O1)C=CC(=C2)C(=O)C)C(=O)C |
Computed by PubChem (NCBI)