Products 1423026-22-5
CAS 1423026-22-5 is the registry number for 2-(1,3-Dimethyl-5-oxo-4,5-dihydro-1h-pyrazol-4-yl)acetic acid hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(1,3-dimethyl-5-oxo-4H-pyrazol-4-yl)acetic acid;hydrochloride (CAS 1423026-22-5) is a chemical compound with the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. IUPAC name: 2-(1,3-dimethyl-5-oxo-4H-pyrazol-4-yl)acetic acid;hydrochloride. InChIKey: QMDCTRATYQYOBE-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O3 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 2-(1,3-dimethyl-5-oxo-4H-pyrazol-4-yl)acetic acid;hydrochloride |
| InChIKey | QMDCTRATYQYOBE-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)C1CC(=O)O)C.Cl |
Computed by PubChem (NCBI)