CAS 1823247-44-4 is the registry number for 3-(Azetidin-3-ylmethyl)oxazolidine-2,4-dione hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(azetidin-3-ylmethyl)-1,3-oxazolidine-2,4-dione;hydrochloride (CAS 1823247-44-4) is a chemical compound with the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. IUPAC name: 3-(azetidin-3-ylmethyl)-1,3-oxazolidine-2,4-dione;hydrochloride. InChIKey: NNTGFDSRELUWAO-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O3 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 3-(azetidin-3-ylmethyl)-1,3-oxazolidine-2,4-dione;hydrochloride |
| InChIKey | NNTGFDSRELUWAO-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CN2C(=O)COC2=O.Cl |
Computed by PubChem (NCBI)