CAS 1427378-57-1 appears in our catalog under these names: 5-((Dimethylamino)methyl)-1,2-oxazole-3-carboxylic acid hydrochloride, 95%, 5-((Dimethylamino)methyl)-1,2-oxazole-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
5-[(dimethylamino)methyl]-1,2-oxazole-3-carboxylic acid;hydrochloride (CAS 1427378-57-1) is a chemical compound with the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. IUPAC name: 5-[(dimethylamino)methyl]-1,2-oxazole-3-carboxylic acid;hydrochloride. InChIKey: IXUHHRRTQBBWKZ-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN2O3 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 5-[(dimethylamino)methyl]-1,2-oxazole-3-carboxylic acid;hydrochloride |
| InChIKey | IXUHHRRTQBBWKZ-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=CC(=NO1)C(=O)O.Cl |
Computed by PubChem (NCBI)