Products 2137730-87-9

CAS 2137730-87-9 is the registry number for 3-(2-Aminopropan-2-yl)-1,2-oxazole-4-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(2-aminopropan-2-yl)-1,2-oxazole-4-carboxylic acid;hydrochloride (CAS 2137730-87-9) is a chemical compound with the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. IUPAC name: 3-(2-aminopropan-2-yl)-1,2-oxazole-4-carboxylic acid;hydrochloride. InChIKey: OVLIKJOQABBKIZ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O3
Molecular weight206.63 g/mol
IUPAC name3-(2-aminopropan-2-yl)-1,2-oxazole-4-carboxylic acid;hydrochloride
InChIKeyOVLIKJOQABBKIZ-UHFFFAOYSA-N
SMILESCC(C)(C1=NOC=C1C(=O)O)N.Cl

Computed by PubChem (NCBI)