Products 1909315-93-0

CAS 1909315-93-0 is the registry number for Ethyl 2-(methylamino)-1,3-oxazole-4-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl 2-(methylamino)-1,3-oxazole-4-carboxylate;hydrochloride (CAS 1909315-93-0) is a chemical compound with the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. IUPAC name: ethyl 2-(methylamino)-1,3-oxazole-4-carboxylate;hydrochloride. InChIKey: AKBWORGKIZFPKT-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN2O3
Molecular weight206.63 g/mol
IUPAC nameethyl 2-(methylamino)-1,3-oxazole-4-carboxylate;hydrochloride
InChIKeyAKBWORGKIZFPKT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=COC(=N1)NC.Cl

Computed by PubChem (NCBI)