CAS 1423027-76-2 appears in our catalog under these names: 2-Cyclopropyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, 2-Cyclopropyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
2-cyclopropyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 1423027-76-2) is a chemical compound with the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. IUPAC name: 2-cyclopropyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: SKFZITCWKMFWBL-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2S |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | 2-cyclopropyl-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | SKFZITCWKMFWBL-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=C(S2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)