CAS 387350-44-9 appears in our catalog under these names: 2-((4-(Trifluoromethyl)pyridin-3-yl)thio)acetic acid, 97%, 2-{[4-(Trifluoromethyl)pyridin-3-yl]thio}acetic acid, 97%. Offered by: AmBeed, Fluorochem. Available pack sizes: 25g, 1g, 5g.
2-[[4-(trifluoromethyl)-3-pyridinyl]sulfanyl]acetic acid (CAS 387350-44-9) is a chemical compound with the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. IUPAC name: 2-[[4-(trifluoromethyl)-3-pyridinyl]sulfanyl]acetic acid. InChIKey: XPBACFWQIBVREX-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2S |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | 2-[[4-(trifluoromethyl)-3-pyridinyl]sulfanyl]acetic acid |
| InChIKey | XPBACFWQIBVREX-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(F)(F)F)SCC(=O)O |
Computed by PubChem (NCBI)