Products 1860910-16-2
CAS 1860910-16-2 is the registry number for Methyl 5-((trifluoromethyl)thio)nicotinate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-(trifluoromethylsulfanyl)pyridine-3-carboxylate (CAS 1860910-16-2) is a chemical compound with the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. IUPAC name: methyl 5-(trifluoromethylsulfanyl)pyridine-3-carboxylate. InChIKey: NSKDCRVVHZZBSA-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2S |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | methyl 5-(trifluoromethylsulfanyl)pyridine-3-carboxylate |
| InChIKey | NSKDCRVVHZZBSA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CN=C1)SC(F)(F)F |
Computed by PubChem (NCBI)