Products 2168403-84-5
CAS 2168403-84-5 is the registry number for 2-(1-(Trifluoromethyl)cyclopropyl)thiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboxylic acid (CAS 2168403-84-5) is a chemical compound with the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. IUPAC name: 2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboxylic acid. InChIKey: KGKIIZITTOFJGF-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2S |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | 2-[1-(trifluoromethyl)cyclopropyl]-1,3-thiazole-4-carboxylic acid |
| InChIKey | KGKIIZITTOFJGF-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=NC(=CS2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)