CAS 2924153-71-7 is the registry number for (E)-4-(Prop-1-en-1-yl)-2-(trifluoromethyl)thiazole-5-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(E)-prop-1-enyl]-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CAS 2924153-71-7) is a chemical compound with the molecular formula C8H6F3NO2S and a molecular weight of 237.20 g/mol. IUPAC name: 4-[(E)-prop-1-enyl]-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid. InChIKey: VCQNTNHDHMUODS-NSCUHMNNSA-N.
| Molecular formula | C8H6F3NO2S |
|---|---|
| Molecular weight | 237.20 g/mol |
| IUPAC name | 4-[(E)-prop-1-enyl]-2-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | VCQNTNHDHMUODS-NSCUHMNNSA-N |
| SMILES | C/C=C/C1=C(SC(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)