CAS 1423028-22-1 appears in our catalog under these names: 1-(2,3-Dihydro-1,4-benzodioxine-6-sulfonyl)azetidin-3-amine, 95%, 1-(2,3-Dihydro-1,4-benzodioxine-6-sulfonyl)azetidin-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-amine (CAS 1423028-22-1) is a chemical compound with the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. IUPAC name: 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-amine. InChIKey: QXLPIDJCHJYKOC-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O4S |
|---|---|
| Molecular weight | 270.31 g/mol |
| IUPAC name | 1-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)azetidin-3-amine |
| InChIKey | QXLPIDJCHJYKOC-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)N3CC(C3)N |
Computed by PubChem (NCBI)