CAS 1423032-46-5 appears in our catalog under these names: 2-((Dimethylamino)methyl)pyridin-4-amine dihydrochloride, 97%, 2-((Dimethylamino)methyl)pyridin-4-amine dihydrochloride, 2-[(dimethylamino)methyl]pyridin-4-amine dihydrochloride, 97%, 97%, 2-[(dimethylamino)methyl]pyridin-4-amine dihydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 0,5g, 250mg, 1g, 100mg, 500mg, 2.5g.
2-[(dimethylamino)methyl]pyridin-4-amine;dihydrochloride (CAS 1423032-46-5) is a chemical compound with the molecular formula C8H15Cl2N3 and a molecular weight of 224.13 g/mol. IUPAC name: 2-[(dimethylamino)methyl]pyridin-4-amine;dihydrochloride. InChIKey: FMYXAZBHVHHQPA-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3 |
|---|---|
| Molecular weight | 224.13 g/mol |
| IUPAC name | 2-[(dimethylamino)methyl]pyridin-4-amine;dihydrochloride |
| InChIKey | FMYXAZBHVHHQPA-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC=CC(=C1)N.Cl.Cl |
Computed by PubChem (NCBI)