CAS 1423033-85-5 appears in our catalog under these names: 4-(Chloromethyl)-N,N-dimethylfuran-2-sulfonamide, 95%, 4-(Chloromethyl)-N,N-dimethylfuran-2-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
4-(chloromethyl)-N,N-dimethylfuran-2-sulfonamide (CAS 1423033-85-5) is a chemical compound with the molecular formula C7H10ClNO3S and a molecular weight of 223.68 g/mol. IUPAC name: 4-(chloromethyl)-N,N-dimethylfuran-2-sulfonamide. InChIKey: DQINYDLOIUHNBF-UHFFFAOYSA-N.
| Molecular formula | C7H10ClNO3S |
|---|---|
| Molecular weight | 223.68 g/mol |
| IUPAC name | 4-(chloromethyl)-N,N-dimethylfuran-2-sulfonamide |
| InChIKey | DQINYDLOIUHNBF-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=CO1)CCl |
Computed by PubChem (NCBI)